EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17NO5.C22H18I6N2O9 |
| Net Charge | 0 |
| Average Mass | 1411.030 |
| Monoisotopic Mass | 1410.63874 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(COCCOCCOCC(=O)Nc1c(I)cc(I)c(C(=O)O)c1I)Nc1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C22H18I6N2O9.C7H17NO5/c23-9-5-11(25)19(17(27)15(9)21(33)34)29-13(31)7-38-3-1-37-2-4-39-8-14(32)30-20-12(26)6-10(24)16(18(20)28)22(35)36;1-8-2-4(10)6(12)7(13)5(11)3-9/h5-6H,1-4,7-8H2,(H,29,31)(H,30,32)(H,33,34)(H,35,36);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | WLQIGBUDSUVJCO-WZTVWXICSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iotroxate meglumine (CHEBI:756677) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Iotroxamide | ChEMBL |
| Iotroxate meglumine | ChEMBL |
| Meglumine iotroxate | ChEMBL |
| Meglumine iotroxinate | ChEMBL |