EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C21H21FN6O.C3H6O3 |
| Net Charge | 0 |
| Average Mass | 500.531 |
| Monoisotopic Mass | 500.21835 |
| SMILES | CC(O)C(=O)O.CN1CCN(c2ccc3nc(-c4c(N)c5c(F)cccc5nc4=O)nc3c2)CC1.O |
| InChI | InChI=1S/C21H21FN6O.C3H6O3.H2O/c1-27-7-9-28(10-8-27)12-5-6-14-16(11-12)25-20(24-14)18-19(23)17-13(22)3-2-4-15(17)26-21(18)29;1-2(4)3(5)6;/h2-6,11H,7-10H2,1H3,(H,24,25)(H3,23,26,29);2,4H,1H3,(H,5,6);1H2 |
| InChIKey | QDPVYZNVVQQULH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dovitinib lactate (CHEBI:756669) has role antineoplastic agent (CHEBI:35610) |
| dovitinib lactate (CHEBI:756669) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Chir-258 (hydrate) | ChEMBL |
| Dovitinib lactate | ChEMBL |
| Dovitinib lactate hydrate | ChEMBL |
| Tki258 (hydrate) | ChEMBL |