EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20BN3O3 |
| Net Charge | 0 |
| Average Mass | 241.100 |
| Monoisotopic Mass | 241.15977 |
| SMILES | O=C(CN[C@@H]1CCNC1)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C10H20BN3O3/c15-10(7-13-8-3-4-12-6-8)14-5-1-2-9(14)11(16)17/h8-9,12-13,16-17H,1-7H2/t8-,9+/m1/s1 |
| InChIKey | DVJAMEIQRSHVKC-BDAKNGLRSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dutogliptin (CHEBI:756668) has role cardiovascular drug (CHEBI:35554) |
| dutogliptin (CHEBI:756668) has role hypoglycemic agent (CHEBI:35526) |
| dutogliptin (CHEBI:756668) is a amino acid amide (CHEBI:22475) |
| INNs | Source |
|---|---|
| dutogliptin | WHO MedNet |
| dutogliptina | WHO MedNet |
| dutogliptine | WHO MedNet |
| Synonym | Source |
|---|---|
| PHX1149 | ChEMBL |
| Citations |
|---|