EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35ClN6O2S |
| Net Charge | 0 |
| Average Mass | 519.115 |
| Monoisotopic Mass | 518.22307 |
| SMILES | COC[C@@H](C)N[C@H]1CC[C@H](Nc2cc(-c3csc(NCC4(C#N)CCOCC4)n3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C25H35ClN6O2S/c1-17(13-33-2)30-18-3-5-19(6-4-18)31-23-11-20(21(26)12-28-23)22-14-35-24(32-22)29-16-25(15-27)7-9-34-10-8-25/h11-12,14,17-19,30H,3-10,13,16H2,1-2H3,(H,28,31)(H,29,32)/t17-,18-,19-/m1/s1 |
| InChIKey | PGVNLOUNSPQGJP-GUDVDZBRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tambiciclib (CHEBI:756666) has role antineoplastic agent (CHEBI:35610) |
| tambiciclib (CHEBI:756666) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| tambiciclib | WHO MedNet |
| Citations |
|---|