EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O8S |
| Net Charge | 0 |
| Average Mass | 393.418 |
| Monoisotopic Mass | 393.12059 |
| SMILES | [H][C@@]12CC[C@@H](C(N)=O)N(C1)C(=O)N2OS(=O)(=O)OCC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C14H23N3O8S/c1-4-23-12(19)14(2,3)8-24-26(21,22)25-17-9-5-6-10(11(15)18)16(7-9)13(17)20/h9-10H,4-8H2,1-3H3,(H2,15,18)/t9-,10+/m1/s1 |
| InChIKey | JHSLCXRZVJOZQZ-ZJUUUORDSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avibactam tomilopil (CHEBI:756663) has role antibacterial agent (CHEBI:33282) |
| avibactam tomilopil (CHEBI:756663) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| avibactam tomilopil | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARX-1796 | ChEMBL |
| PF-07338233 | ChEMBL |
| Brand Name | Source |
|---|---|
| Avibactam tomilopil component of pf-07612577 pf-07338233 | ChEMBL |
| Citations |
|---|