EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756662 - sutidiazine
| Formula | C24H32FN9 |
| Net Charge | 0 |
| Average Mass | 465.581 |
| Monoisotopic Mass | 465.27647 |
| SMILES | Cc1nc(Nc2ncc(N3CCN(C)[C@H](C)C3)c(Nc3cc(C)n(C)n3)n2)cc(C2CC2)c1F |
| InChI | InChI=1S/C24H32FN9/c1-14-10-21(31-33(14)5)28-23-19(34-9-8-32(4)15(2)13-34)12-26-24(30-23)29-20-11-18(17-6-7-17)22(25)16(3)27-20/h10-12,15,17H,6-9,13H2,1-5H3,(H2,26,27,28,29,30,31)/t15-/m1/s1 |
| InChIKey | HKPQFVAUXAZCDY-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sutidiazine (CHEBI:756662) has role antineoplastic agent (CHEBI:35610) |
| sutidiazine (CHEBI:756662) is a N-arylpiperazine (CHEBI:46848) |
| INNs | Source |
|---|---|
| sutidiazina | WHO MedNet |
| sutidiazine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mmv-253 | ChEMBL |
| MMV253 | ChEMBL |
| Zy-19489 | ChEMBL |
| ZY19489 | ChEMBL |
| Citations |
|---|