EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N5O3S |
| Net Charge | 0 |
| Average Mass | 447.520 |
| Monoisotopic Mass | 447.13651 |
| SMILES | Cn1cc(-c2ccc(S(=O)(=O)n3ccc(/C=C/C(=O)Nc4ccccc4N)c3)cc2)cn1 |
| InChI | InChI=1S/C23H21N5O3S/c1-27-16-19(14-25-27)18-7-9-20(10-8-18)32(30,31)28-13-12-17(15-28)6-11-23(29)26-22-5-3-2-4-21(22)24/h2-16H,24H2,1H3,(H,26,29)/b11-6+ |
| InChIKey | PRXXYMVLYKJITB-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| domatinostat (CHEBI:756661) has role antineoplastic agent (CHEBI:35610) |
| domatinostat (CHEBI:756661) is a pyrazoles (CHEBI:26410) |
| domatinostat (CHEBI:756661) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| domatinostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4sc-202 | ChEMBL |
| Hdac inhibitor 4sc-202 | ChEMBL |
| Citations |
|---|