EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13ClF6N6 |
| Net Charge | 0 |
| Average Mass | 414.741 |
| Monoisotopic Mass | 414.07944 |
| SMILES | C[C@@H](Nc1nc(N[C@H](C)C(F)(F)F)nc(-c2cccc(Cl)n2)n1)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF6N6/c1-6(13(16,17)18)22-11-25-10(8-4-3-5-9(15)24-8)26-12(27-11)23-7(2)14(19,20)21/h3-7H,1-2H3,(H2,22,23,25,26,27)/t6-,7-/m1/s1 |
| InChIKey | QCZAWDGAVJMPTA-RNFRBKRXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorasidenib (CHEBI:756658) has role antineoplastic agent (CHEBI:35610) |
| vorasidenib (CHEBI:756658) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| AG-881 | ChEMBL |
| Vorasidenib | ChEMBL |
| Brand Name | Source |
|---|---|
| Voranigo | ChEMBL |
| Citations |
|---|