EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H21FN2O |
| Net Charge | 0 |
| Average Mass | 420.915 |
| Monoisotopic Mass | 420.14047 |
| SMILES | CC1=C(CC(=O)NCc2ccccc2)c2cc(F)ccc2/C1=C\c1ccncc1.Cl |
| InChI | InChI=1S/C25H21FN2O.ClH/c1-17-22(13-18-9-11-27-12-10-18)21-8-7-20(26)14-24(21)23(17)15-25(29)28-16-19-5-3-2-4-6-19;/h2-14H,15-16H2,1H3,(H,28,29);1H/b22-13-; |
| InChIKey | KGXPDNOBLLACKL-BWLGBDCWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cp-461 (CHEBI:756655) has role antineoplastic agent (CHEBI:35610) |
| cp-461 (CHEBI:756655) is a indene (CHEBI:37910) |
| Synonyms | Source |
|---|---|
| Cp 461 | ChEMBL |
| Cp-461 | ChEMBL |
| OSI-461 | ChEMBL |
| Citations |
|---|