EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO3 |
| Net Charge | 0 |
| Average Mass | 339.435 |
| Monoisotopic Mass | 339.18344 |
| SMILES | COc1ccc2c(c1)CC[C@H](CN(C)CC(=O)O)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-22(14-20(23)24)13-17-9-8-16-12-18(25-2)10-11-19(16)21(17)15-6-4-3-5-7-15/h3-7,10-12,17,21H,8-9,13-14H2,1-2H3,(H,23,24)/t17-,21+/m1/s1 |
| InChIKey | UEBBYLJZCHTLEG-UTKZUKDTSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| org-25935 (CHEBI:756652) has role antidepressant (CHEBI:35469) |
| org-25935 (CHEBI:756652) has role antipsychotic agent (CHEBI:35476) |
| org-25935 (CHEBI:756652) is a tetralins (CHEBI:36786) |
| Synonyms | Source |
|---|---|
| Org-25935 | ChEMBL |
| ORG 25935 | ChEMBL |
| Org-25935 free base | ChEMBL |
| SCH 900435 | ChEMBL |
| SCH-900435 | ChEMBL |
| Citations |
|---|