EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21BrFN5O2 |
| Net Charge | 0 |
| Average Mass | 510.367 |
| Monoisotopic Mass | 509.08627 |
| SMILES | CCn1c(=O)c(-c2cc(NC(=O)Nc3ccccc3)c(F)cc2Br)cc2cnc(NC)cc21 |
| InChI | InChI=1S/C24H21BrFN5O2/c1-3-31-21-12-22(27-2)28-13-14(21)9-17(23(31)32)16-10-20(19(26)11-18(16)25)30-24(33)29-15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,27,28)(H2,29,30,33) |
| InChIKey | CEFJVGZHQAGLHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ripretinib (CHEBI:756647) has role antineoplastic agent (CHEBI:35610) |
| ripretinib (CHEBI:756647) is a naphthyridine derivative (CHEBI:73539) |
| Synonyms | Source |
|---|---|
| DCC-2618 | ChEMBL |
| Ripretinib | ChEMBL |
| Brand Name | Source |
|---|---|
| Qinlock | ChEMBL |
| Citations |
|---|