EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22ClN7O3 |
| Net Charge | 0 |
| Average Mass | 479.928 |
| Monoisotopic Mass | 479.14727 |
| SMILES | CC(C)(CO)n1cc(C(=O)c2cncc(NC(=O)Cc3ccc(Cl)cn3)c2)c2cnc(N)nc21 |
| InChI | InChI=1S/C23H22ClN7O3/c1-23(2,12-32)31-11-18(17-10-28-22(25)30-21(17)31)20(34)13-5-16(9-26-7-13)29-19(33)6-15-4-3-14(24)8-27-15/h3-5,7-11,32H,6,12H2,1-2H3,(H,29,33)(H2,25,28,30) |
| InChIKey | BPIWZDNVMQQBQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-06273340 (CHEBI:756645) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Synonyms | Source |
|---|---|
| Pf-06273340 | ChEMBL |
| PF06273340 | ChEMBL |
| Citations |
|---|