EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N4O2 |
| Net Charge | 0 |
| Average Mass | 408.461 |
| Monoisotopic Mass | 408.15863 |
| SMILES | N#Cc1ccc(-c2cnc3ccc(-c4ccc(C(=O)N5CCOCC5)cc4)cn23)cc1 |
| InChI | InChI=1S/C25H20N4O2/c26-15-18-1-3-20(4-2-18)23-16-27-24-10-9-22(17-29(23)24)19-5-7-21(8-6-19)25(30)28-11-13-31-14-12-28/h1-10,16-17H,11-14H2 |
| InChIKey | FWRFPHJSGLYXTD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinodasertib (CHEBI:756644) has role antineoplastic agent (CHEBI:35610) |
| tinodasertib (CHEBI:756644) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| tinodasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aum001 | ChEMBL |
| AUM-001 | ChEMBL |
| ETC1907206 | ChEMBL |
| Etc-206 | ChEMBL |
| Citations |
|---|