EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N8O4S |
| Net Charge | 0 |
| Average Mass | 476.563 |
| Monoisotopic Mass | 476.19542 |
| SMILES | CCOCCn1nc(C(=O)NS(C)(=O)=O)c2nc(N(C)CC)nc(Nc3cc(C)ccn3)c21 |
| InChI | InChI=1S/C20H28N8O4S/c1-6-27(4)20-23-15-16(19(29)26-33(5,30)31)25-28(10-11-32-7-2)17(15)18(24-20)22-14-12-13(3)8-9-21-14/h8-9,12H,6-7,10-11H2,1-5H3,(H,26,29)(H,21,22,23,24) |
| InChIKey | ZUHZNKJIJDAJFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-00489791 (CHEBI:756642) has role antihypertensive agent (CHEBI:35674) |
| pf-00489791 (CHEBI:756642) has role hypoglycemic agent (CHEBI:35526) |
| pf-00489791 (CHEBI:756642) is a pyrazolopyrimidine (CHEBI:38669) |
| Synonyms | Source |
|---|---|
| Pf-00489791 | ChEMBL |
| PF-489,791 | ChEMBL |
| UK-489,791 | ChEMBL |
| Citations |
|---|