EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23FN8O2 |
| Net Charge | 0 |
| Average Mass | 498.522 |
| Monoisotopic Mass | 498.19280 |
| SMILES | Cn1cc(Nc2nc(N)nc(-c3cccc(-n4ccc5cc(C6CC6)cc(F)c5c4=O)c3CO)n2)cn1 |
| InChI | InChI=1S/C26H23FN8O2/c1-34-12-17(11-29-34)30-26-32-23(31-25(28)33-26)18-3-2-4-21(19(18)13-36)35-8-7-15-9-16(14-5-6-14)10-20(27)22(15)24(35)37/h2-4,7-12,14,36H,5-6,13H2,1H3,(H3,28,30,31,32,33) |
| InChIKey | RQYDQAPLARKISN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sofnobrutinib (CHEBI:756641) has role antineoplastic agent (CHEBI:35610) |
| sofnobrutinib (CHEBI:756641) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| sofnobrutinib | WHO MedNet |
| Synonym | Source |
|---|---|
| AS-0871 | ChEMBL |
| Citations |
|---|