EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O4S.C22H43N5O13.H2O4S |
| Net Charge | 0 |
| Average Mass | 781.766 |
| Monoisotopic Mass | 781.22050 |
| SMILES | O=S(=O)(O)O.O=S(=O)(O)O.[H][C@]1(O[C@@H]2[C@@H](O)[C@H](O[C@@]3([H])O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](N)C[C@H]2NC(=O)[C@@H](O)CCN)O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O |
| InChI | InChI=1S/C22H43N5O13.2H2O4S/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21;2*1-5(2,3)4/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36);2*(H2,1,2,3,4)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+;;/m0../s1 |
| InChIKey | FXKSEJFHKVNEFI-GCZBSULCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amikacin sulfate (CHEBI:756639) has role antibacterial agent (CHEBI:33282) |
| amikacin sulfate (CHEBI:756639) has role antiinfective agent (CHEBI:35441) |
| amikacin sulfate (CHEBI:756639) has role antimicrobial agent (CHEBI:33281) |
| amikacin sulfate (CHEBI:756639) is a amino cyclitol (CHEBI:61689) |
| Synonyms | Source |
|---|---|
| Amikacin (as sulfate) | ChEMBL |
| Amikacini sulfas | ChEMBL |
| Amikacin sulphate | ChEMBL |
| Arikayce | ChEMBL |
| BB-K8 | ChEMBL |
| NSC-755846 | ChEMBL |
| Brand Names | Source |
|---|---|
| Arikayce kit | ChEMBL |
| Arikayce liposomal | ChEMBL |
| Citations |
|---|