EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18ClF2N5O3 |
| Net Charge | 0 |
| Average Mass | 449.845 |
| Monoisotopic Mass | 449.10662 |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(N2CC[C@@H](O)C2)c(-c2ccnn2)c1 |
| InChI | InChI=1S/C20H18ClF2N5O3/c21-20(22,23)31-15-3-1-13(2-4-15)26-19(30)12-9-16(17-5-7-25-27-17)18(24-10-12)28-8-6-14(29)11-28/h1-5,7,9-10,14,29H,6,8,11H2,(H,25,27)(H,26,30)/t14-/m1/s1 |
| InChIKey | VOVZXURTCKPRDQ-CQSZACIVSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asciminib (CHEBI:756638) has role antineoplastic agent (CHEBI:35610) |
| asciminib (CHEBI:756638) has role renoprotective agent (CHEBI:231911) |
| asciminib (CHEBI:756638) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| ABL-001 | ChEMBL |
| ABL001 | ChEMBL |
| ABL001-NX | ChEMBL |
| Asciminib | ChEMBL |
| NVP-ABL001 | ChEMBL |
| Citations |
|---|