EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N6O10S2 |
| Net Charge | 0 |
| Average Mass | 518.486 |
| Monoisotopic Mass | 518.05258 |
| SMILES | Nc1nc(/C(=N/OC2(C(=O)O)CC2)C(=O)N[C@@H]2C(=O)N(S(=O)(=O)O)[C@@H]2CN2CCOC2=O)cs1 |
| InChI | InChI=1S/C16H18N6O10S2/c17-14-18-7(6-33-14)9(20-32-16(1-2-16)13(25)26)11(23)19-10-8(5-21-3-4-31-15(21)27)22(12(10)24)34(28,29)30/h6,8,10H,1-5H2,(H2,17,18)(H,19,23)(H,25,26)(H,28,29,30)/b20-9-/t8-,10+/m1/s1 |
| InChIKey | FWTGYTRQUBRVDW-NRABZWKMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ancremonam (CHEBI:756634) has role antibacterial agent (CHEBI:33282) |
| ancremonam (CHEBI:756634) is a monobactam (CHEBI:50695) |
| Synonyms | Source |
|---|---|
| Ancremonam | ChEMBL |
| BOS-228 | ChEMBL |
| LYS-228 | ChEMBL |
| Citations |
|---|