EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47N5O6S |
| Net Charge | 0 |
| Average Mass | 629.824 |
| Monoisotopic Mass | 629.32471 |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H](Cc2cccc(/C(N)=N\O)c2)NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC1 |
| InChI | InChI=1S/C32H47N5O6S/c1-8-43-32(39)37-14-12-36(13-15-37)31(38)28(17-23-10-9-11-24(16-23)30(33)34-40)35-44(41,42)29-26(21(4)5)18-25(20(2)3)19-27(29)22(6)7/h9-11,16,18-22,28,35,40H,8,12-15,17H2,1-7H3,(H2,33,34)/t28-/m0/s1 |
| InChIKey | HUASEDVYRABWCV-NDEPHWFRSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| upamostat (CHEBI:756633) has role antineoplastic agent (CHEBI:35610) |
| upamostat (CHEBI:756633) has role antiviral agent (CHEBI:22587) |
| upamostat (CHEBI:756633) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| upamostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mesupron | ChEMBL |
| WX-671 | ChEMBL |
| Citations |
|---|