EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClF2O4S |
| Net Charge | 0 |
| Average Mass | 442.911 |
| Monoisotopic Mass | 442.08171 |
| SMILES | O=C(O)CC[C@H]1CC[C@@](c2cc(F)ccc2F)(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H21ClF2O4S/c22-15-2-5-17(6-3-15)29(27,28)21(18-13-16(23)4-7-19(18)24)11-9-14(10-12-21)1-8-20(25)26/h2-7,13-14H,1,8-12H2,(H,25,26)/t14-,21+ |
| InChIKey | XCGJIFAKUZNNOR-QCKZDCLWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-0752 (CHEBI:756630) has role antineoplastic agent (CHEBI:35610) |
| mk-0752 (CHEBI:756630) is a sulfonic acid derivative (CHEBI:33552) |
| Synonym | Source |
|---|---|
| Mk-0752 | ChEMBL |
| Citations |
|---|