EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27FN10 |
| Net Charge | 0 |
| Average Mass | 498.570 |
| Monoisotopic Mass | 498.24042 |
| SMILES | Cn1cc(-c2cc3c(N4CCN(c5ncc([C@@](C)(N)c6ccc(F)cc6)cn5)CC4)ncnn3c2)cn1 |
| InChI | InChI=1S/C26H27FN10/c1-26(28,20-3-5-22(27)6-4-20)21-13-29-25(30-14-21)36-9-7-35(8-10-36)24-23-11-18(16-37(23)33-17-31-24)19-12-32-34(2)15-19/h3-6,11-17H,7-10,28H2,1-2H3/t26-/m0/s1 |
| InChIKey | DWYRIWUZIJHQKQ-SANMLTNESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avapritinib (CHEBI:756628) has role antineoplastic agent (CHEBI:35610) |
| avapritinib (CHEBI:756628) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| 70C366 | ChEMBL |
| Avapritinib | ChEMBL |
| BLU-285 | ChEMBL |
| C-366 | ChEMBL |
| X-720776 | ChEMBL |
| X720776 | ChEMBL |
| Brand Names | Source |
|---|---|
| Ayvakit | ChEMBL |
| Ayvakyt | ChEMBL |
| Citations |
|---|