EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42FN5O3 |
| Net Charge | 0 |
| Average Mass | 539.696 |
| Monoisotopic Mass | 539.32717 |
| SMILES | C[C@@H]1CN(CC(=O)N2CC(C)(C)c3nc(CO)c(Cc4ccc(F)cc4)cc32)[C@@H](CN2CCOC[C@H]2C)CN1 |
| InChI | InChI=1S/C30H42FN5O3/c1-20-14-35(25(13-32-20)15-34-9-10-39-18-21(34)2)16-28(38)36-19-30(3,4)29-27(36)12-23(26(17-37)33-29)11-22-5-7-24(31)8-6-22/h5-8,12,20-21,25,32,37H,9-11,13-19H2,1-4H3/t20-,21-,25-/m1/s1 |
| InChIKey | YCXOHEXZVKOGEV-DNRQZRRGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astx-660 (CHEBI:756626) has role antineoplastic agent (CHEBI:35610) |
| astx-660 (CHEBI:756626) is a N-acylpiperazine (CHEBI:46844) |
| INN | Source |
|---|---|
| tolinapant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Astx 660 | ChEMBL |
| ASTX-660 | ChEMBL |
| ASTX660 | ChEMBL |
| Citations |
|---|