EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F4N6O2 |
| Net Charge | 0 |
| Average Mass | 490.461 |
| Monoisotopic Mass | 490.17404 |
| SMILES | [H][C@]1([C@@H](C)F)COC(=O)N1c1ccnc(N[C@@H](C)c2cc(C)c(-c3ccnc(C(F)(F)F)c3)cn2)n1 |
| InChI | InChI=1S/C23H22F4N6O2/c1-12-8-17(30-10-16(12)15-4-6-28-19(9-15)23(25,26)27)14(3)31-21-29-7-5-20(32-21)33-18(13(2)24)11-35-22(33)34/h4-10,13-14,18H,11H2,1-3H3,(H,29,31,32)/t13-,14+,18-/m1/s1 |
| InChIKey | DCGDPJCUIKLTDU-QWQRMKEZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idh305 (CHEBI:756623) has role antineoplastic agent (CHEBI:35610) |
| idh305 (CHEBI:756623) is a bipyridines (CHEBI:50511) |
| Synonym | Source |
|---|---|
| Idh305 | ChEMBL |
| Citations |
|---|