EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClN2O5 |
| Net Charge | 0 |
| Average Mass | 360.753 |
| Monoisotopic Mass | 360.05130 |
| SMILES | O=C(O)CNC(=O)c1ncc(C#CCOc2ccc(Cl)cc2)cc1O |
| InChI | InChI=1S/C17H13ClN2O5/c18-12-3-5-13(6-4-12)25-7-1-2-11-8-14(21)16(19-9-11)17(24)20-10-15(22)23/h3-6,8-9,21H,7,10H2,(H,20,24)(H,22,23) |
| InChIKey | AIKDJELJHUPYNG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ddo-3055 (CHEBI:756620) is a N-acylglycine (CHEBI:16180) |
| Synonym | Source |
|---|---|
| Ddo-3055 | ChEMBL |
| Citations |
|---|