EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H20ClN3O2 |
| Net Charge | 0 |
| Average Mass | 453.929 |
| Monoisotopic Mass | 453.12440 |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2c(C)cccc2Cl)cc1C#Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H20ClN3O2/c1-17-10-12-22(26(32)30-31-27(33)25-18(2)6-5-8-23(25)28)15-20(17)13-11-19-14-21-7-3-4-9-24(21)29-16-19/h3-10,12,14-16H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | ZQOBVMHBVWNVBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vodobatinib (CHEBI:756619) has role antineoplastic agent (CHEBI:35610) |
| vodobatinib (CHEBI:756619) has role antiparkinson drug (CHEBI:48407) |
| vodobatinib (CHEBI:756619) is a organochlorine compound (CHEBI:36683) |
| vodobatinib (CHEBI:756619) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| vodobatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| K-0706 | ChEMBL |
| K0706 | ChEMBL |
| Sco-088 | ChEMBL |
| Citations |
|---|