EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29FN3O10P |
| Net Charge | 0 |
| Average Mass | 545.457 |
| Monoisotopic Mass | 545.15746 |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(F)O[C@@H](n2ccc(=O)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29FN3O10P/c1-13(2)34-17(28)14(3)25-37(32,36-15-8-6-5-7-9-15)33-12-22(23)18(29)21(4,31)19(35-22)26-11-10-16(27)24-20(26)30/h5-11,13-14,18-19,29,31H,12H2,1-4H3,(H,25,32)(H,24,27,30)/t14-,18-,19+,21+,22+,37-/m0/s1 |
| InChIKey | NIJYGVDQZBBONK-SEUXLIJBSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adafosbuvir (CHEBI:756618) has role antiviral agent (CHEBI:22587) |
| adafosbuvir (CHEBI:756618) is a α-amino acid ester (CHEBI:46874) |
| INN | Source |
|---|---|
| adafosbuvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| AL-335 | ChEMBL |
| JNJ-335 | ChEMBL |
| Citations |
|---|