EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N7O3S |
| Net Charge | 0 |
| Average Mass | 445.549 |
| Monoisotopic Mass | 445.18961 |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(Nc3ncc(C(N)=O)c(NC4CC4)n3)cc2)CC1 |
| InChI | InChI=1S/C20H27N7O3S/c1-2-31(29,30)27-11-9-26(10-12-27)16-7-5-15(6-8-16)24-20-22-13-17(18(21)28)19(25-20)23-14-3-4-14/h5-8,13-14H,2-4,9-12H2,1H3,(H2,21,28)(H2,22,23,24,25) |
| InChIKey | BGLPECHZZQDNCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerdulatinib (CHEBI:756610) has role antineoplastic agent (CHEBI:35610) |
| cerdulatinib (CHEBI:756610) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| cerdulatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| PRT-062070 | ChEMBL |
| Prt-2070 | ChEMBL |
| RVT-502 | ChEMBL |
| Citations |
|---|