EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15FN4O |
| Net Charge | 0 |
| Average Mass | 298.321 |
| Monoisotopic Mass | 298.12299 |
| SMILES | C[C@]12CCCN1CC1=NNC(=O)c3cc(F)cc4nc2c1c34 |
| InChI | InChI=1S/C16H15FN4O/c1-16-3-2-4-21(16)7-11-13-12-9(15(22)20-19-11)5-8(17)6-10(12)18-14(13)16/h5-6,18H,2-4,7H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | DENYZIUJOTUUNY-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pamiparib (CHEBI:756607) has role antineoplastic agent (CHEBI:35610) |
| pamiparib (CHEBI:756607) is a β-carbolines (CHEBI:60834) |
| Synonyms | Source |
|---|---|
| BGB-290 | ChEMBL |
| Pamiparib | ChEMBL |
| Citations |
|---|