EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H23Cl2F2N9O2 |
| Net Charge | 0 |
| Average Mass | 626.455 |
| Monoisotopic Mass | 625.13198 |
| SMILES | C[C@@H]1CCC[C@H](n2cnc(-c3cc(Cl)ccc3-n3cc(Cl)nn3)cc2=O)c2cc(ccn2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C28H23Cl2F2N9O2/c1-15-3-2-4-23(20-9-16(7-8-33-20)26-21(36-27(15)43)12-35-41(26)28(31)32)39-14-34-19(11-25(39)42)18-10-17(29)5-6-22(18)40-13-24(30)37-38-40/h5-15,23,28H,2-4H2,1H3,(H,36,43)/t15-,23+/m1/s1 |
| InChIKey | FSWFYCYPTDLKON-CMJOXMDJSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milvexian (CHEBI:756606) has role anti-arrhythmia drug (CHEBI:38070) |
| milvexian (CHEBI:756606) has role anticoagulant (CHEBI:50249) |
| milvexian (CHEBI:756606) has role cardiovascular drug (CHEBI:35554) |
| milvexian (CHEBI:756606) is a triazoles (CHEBI:35727) |
| INN | Source |
|---|---|
| milvexian | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS 986177 | ChEMBL |
| BMS-986177 | ChEMBL |
| JNJ-70033093 | ChEMBL |
| Citations |
|---|