EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45N5O5S |
| Net Charge | 0 |
| Average Mass | 659.853 |
| Monoisotopic Mass | 659.31414 |
| SMILES | [H][C@]12CC[C@]([H])(CN(C)C1)N2C(=O)[C@@]12Cn3c(c(C4CCCCC4)c4ccc(C(=O)NS(=O)(=O)N(C)C)cc43)-c3ccc(OC)cc3[C@]1([H])C2 |
| InChI | InChI=1S/C36H45N5O5S/c1-38(2)47(44,45)37-34(42)23-10-14-28-31(16-23)40-21-36(35(43)41-24-11-12-25(41)20-39(3)19-24)18-30(36)29-17-26(46-4)13-15-27(29)33(40)32(28)22-8-6-5-7-9-22/h10,13-17,22,24-25,30H,5-9,11-12,18-21H2,1-4H3,(H,37,42)/t24-,25+,30-,36-/m0/s1 |
| InChIKey | ZTTKEBYSXUCBSE-QDFUAKMASA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beclabuvir (CHEBI:756604) has role antiviral agent (CHEBI:22587) |
| beclabuvir (CHEBI:756604) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| beclabuvir | WHO MedNet |
| Synonym | Source |
|---|---|
| BMS-791325 | ChEMBL |
| Citations |
|---|