EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27ClF3N5O3 |
| Net Charge | 0 |
| Average Mass | 561.992 |
| Monoisotopic Mass | 561.17545 |
| SMILES | Nc1nc(O[C@H](c2ccc(Cl)cc2-c2ccccc2)C(F)(F)F)cc(N2CCC3(CC2)CN[C@H](C(=O)O)C3)n1 |
| InChI | InChI=1S/C27H27ClF3N5O3/c28-17-6-7-18(19(12-17)16-4-2-1-3-5-16)23(27(29,30)31)39-22-13-21(34-25(32)35-22)36-10-8-26(9-11-36)14-20(24(37)38)33-15-26/h1-7,12-13,20,23,33H,8-11,14-15H2,(H,37,38)(H2,32,34,35)/t20-,23+/m0/s1 |
| InChIKey | ZNSPHKJFQDEABI-NZQKXSOJSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rodatristat (CHEBI:756603) has role antihypertensive agent (CHEBI:35674) |
| rodatristat (CHEBI:756603) is a biphenyls (CHEBI:22888) |
| rodatristat (CHEBI:756603) is a organochlorine compound (CHEBI:36683) |
| INN | Source |
|---|---|
| rodatristat | WHO MedNet |
| Synonyms | Source |
|---|---|
| KAR-5417 | ChEMBL |
| KAR5417 | ChEMBL |
| RVT-1201/014 | ChEMBL |
| Citations |
|---|