EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O3 |
| Net Charge | 0 |
| Average Mass | 337.379 |
| Monoisotopic Mass | 337.14264 |
| SMILES | CC(C)n1nccc1-c1ncccc1COc1cccc(O)c1C=O |
| InChI | InChI=1S/C19H19N3O3/c1-13(2)22-16(8-10-21-22)19-14(5-4-9-20-19)12-25-18-7-3-6-17(24)15(18)11-23/h3-11,13,24H,12H2,1-2H3 |
| InChIKey | FWCVZAQENIZVMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| voxelotor (CHEBI:756602) has role anti-anaemic agent (CHEBI:75835) |
| voxelotor (CHEBI:756602) has role antifibrotic agent (CHEBI:233423) |
| voxelotor (CHEBI:756602) has role renoprotective agent (CHEBI:231911) |
| voxelotor (CHEBI:756602) is a hydroxybenzaldehyde (CHEBI:24673) |
| Synonyms | Source |
|---|---|
| GBT-440 | ChEMBL |
| GBT440 | ChEMBL |
| GTX-011 | ChEMBL |
| Voxelotor | ChEMBL |
| Brand Name | Source |
|---|---|
| Oxbryta | ChEMBL |
| Citations |
|---|