EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O3 |
| Net Charge | 0 |
| Average Mass | 337.379 |
| Monoisotopic Mass | 337.14264 |
| SMILES | CC(C)n1nccc1-c1ncccc1COc1cccc(O)c1C=O |
| InChI | InChI=1S/C19H19N3O3/c1-13(2)22-16(8-10-21-22)19-14(5-4-9-20-19)12-25-18-7-3-6-17(24)15(18)11-23/h3-11,13,24H,12H2,1-2H3 |
| InChIKey | FWCVZAQENIZVMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. renoprotective agent Any compound that is able to prevent damage to the kidneys. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| voxelotor (CHEBI:756602) has role anti-anaemic agent (CHEBI:75835) |
| voxelotor (CHEBI:756602) has role antifibrotic agent (CHEBI:233423) |
| voxelotor (CHEBI:756602) has role renoprotective agent (CHEBI:231911) |
| voxelotor (CHEBI:756602) is a hydroxybenzaldehyde (CHEBI:24673) |
| Synonyms | Source |
|---|---|
| GBT-440 | ChEMBL |
| GBT440 | ChEMBL |
| GTX-011 | ChEMBL |
| Voxelotor | ChEMBL |
| Brand Name | Source |
|---|---|
| Oxbryta | ChEMBL |
| Citations |
|---|