EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 395.434 |
| Monoisotopic Mass | 395.16452 |
| SMILES | COC1CCN(C(=O)c2cc(Cc3nnc(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C22H22FN3O3/c1-29-15-8-10-26(11-9-15)22(28)18-12-14(6-7-19(18)23)13-20-16-4-2-3-5-17(16)21(27)25-24-20/h2-7,12,15H,8-11,13H2,1H3,(H,25,27) |
| InChIKey | HYNBNUYQTQIHJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd2461 (CHEBI:756600) has role antineoplastic agent (CHEBI:35610) |
| azd2461 (CHEBI:756600) is a N-acylpiperidine (CHEBI:48591) |
| Synonym | Source |
|---|---|
| Azd2461 | ChEMBL |
| Citations |
|---|