EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N3O5S |
| Net Charge | 0 |
| Average Mass | 287.297 |
| Monoisotopic Mass | 287.05759 |
| SMILES | CC1CS(=O)(=O)CCN1/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H13N3O5S/c1-8-7-19(16,17)5-4-12(8)11-6-9-2-3-10(18-9)13(14)15/h2-3,6,8H,4-5,7H2,1H3/b11-6+ |
| InChIKey | ARFHIAQFJWUCFH-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nifurtimox (CHEBI:7566) is a nitrofuran antibiotic (CHEBI:87230) |
| Synonyms | Source |
|---|---|
| Nifurtimox | KEGG COMPOUND |
| Bayer 2502 | DrugCentral |
| lampit | DrugCentral |