EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O |
| Net Charge | 0 |
| Average Mass | 204.313 |
| Monoisotopic Mass | 204.15142 |
| SMILES | CC(C)c1cccc([C@H](C)C2CC2)c1O |
| InChI | InChI=1S/C14H20O/c1-9(2)12-5-4-6-13(14(12)15)10(3)11-7-8-11/h4-6,9-11,15H,7-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | BMEARIQHWSVDBS-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anaesthetic Substance which produces loss of feeling or sensation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cipepofol (CHEBI:756598) has role anaesthetic (CHEBI:38867) |
| cipepofol (CHEBI:756598) has role antidepressant (CHEBI:35469) |
| cipepofol (CHEBI:756598) has role renoprotective agent (CHEBI:231911) |
| cipepofol (CHEBI:756598) is a alkylbenzene (CHEBI:38976) |
| INN | Source |
|---|---|
| cipepofol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ciprofol | ChEMBL |
| HSK-3486 | ChEMBL |
| HSK3486 | ChEMBL |
| HSK-3486, (R)- | ChEMBL |
| Citations |
|---|