EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N6O2S |
| Net Charge | 0 |
| Average Mass | 468.542 |
| Monoisotopic Mass | 468.13684 |
| SMILES | NS(=O)(=O)c1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3n2)c1 |
| InChI | InChI=1S/C25H20N6O2S/c26-34(32,33)20-13-18(14-27-16-20)24-30-22-11-6-10-21(17-7-2-1-3-8-17)23(22)25(31-24)29-15-19-9-4-5-12-28-19/h1-14,16H,15H2,(H2,26,32,33)(H,29,30,31) |
| InChIKey | XGKULQQVQWCASY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-919373 (CHEBI:756597) has role anti-arrhythmia drug (CHEBI:38070) |
| bms-919373 (CHEBI:756597) has role cardiovascular drug (CHEBI:35554) |
| bms-919373 (CHEBI:756597) is a quinazolines (CHEBI:38530) |
| Synonym | Source |
|---|---|
| Bms-919373 | ChEMBL |
| Citations |
|---|