EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31FN4O2 |
| Net Charge | 0 |
| Average Mass | 462.569 |
| Monoisotopic Mass | 462.24310 |
| SMILES | O=C(NCCN1CCCC1)c1cc(-c2ccc(CN3CCOCC3)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C27H31FN4O2/c28-22-7-8-25-23(17-22)24(27(33)29-9-12-31-10-1-2-11-31)18-26(30-25)21-5-3-20(4-6-21)19-32-13-15-34-16-14-32/h3-8,17-18H,1-2,9-16,19H2,(H,29,33) |
| InChIKey | BENUHBSJOJMZEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabamiquine (CHEBI:756594) has role antimalarial (CHEBI:38068) |
| cabamiquine (CHEBI:756594) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| cabamiquina | WHO MedNet |
| cabamiquine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DDD-107498 | ChEMBL |
| DDD107498 | ChEMBL |
| DDD498 | ChEMBL |
| M-5717 | ChEMBL |
| M5717 | ChEMBL |
| MMV-121 | ChEMBL |
| Citations |
|---|