EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N3O3S |
| Net Charge | 0 |
| Average Mass | 421.522 |
| Monoisotopic Mass | 421.14601 |
| SMILES | O/N=c1\cc(-c2cc3sccc3cn2)oc2ccc(CCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C23H23N3O3S/c27-25-19-13-22(20-14-23-17(15-24-20)5-11-30-23)29-21-4-3-16(12-18(19)21)2-1-6-26-7-9-28-10-8-26/h3-5,11-15,27H,1-2,6-10H2/b25-19+ |
| InChIKey | ZTEDNASHAWNBKQ-NCELDCMTSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| foliglurax (CHEBI:756590) has role antiparkinson drug (CHEBI:48407) |
| foliglurax (CHEBI:756590) is a 1-benzopyran (CHEBI:38443) |
| INN | Source |
|---|---|
| foliglurax | WHO MedNet |
| Synonyms | Source |
|---|---|
| DT-1687 | ChEMBL |
| DT1687 | ChEMBL |
| PXT-002331 | ChEMBL |
| PXT002331 | ChEMBL |
| Citations |
|---|