EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30FN5O3 |
| Net Charge | 0 |
| Average Mass | 527.600 |
| Monoisotopic Mass | 527.23327 |
| SMILES | C[C@H](CN1CCOCC1)n1/c(=N\C(N)=O)nc2cc(/C=C3\c4ccccc4COc4cc(F)ccc43)ccc21 |
| InChI | InChI=1S/C30H30FN5O3/c1-19(17-35-10-12-38-13-11-35)36-27-9-6-20(15-26(27)33-30(36)34-29(32)37)14-25-23-5-3-2-4-21(23)18-39-28-16-22(31)7-8-24(25)28/h2-9,14-16,19H,10-13,17-18H2,1H3,(H3,32,33,34,37)/b25-14+/t19-/m1/s1 |
| InChIKey | YPCLDHGBEKZGEB-RUDKWAFVSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly2623091 (CHEBI:756589) has role antihypertensive agent (CHEBI:35674) |
| ly2623091 (CHEBI:756589) is a dibenzooxazepine (CHEBI:53802) |
| Synonyms | Source |
|---|---|
| Ly-2623091 | ChEMBL |
| Ly2623091 | ChEMBL |
| Citations |
|---|