EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20F3N7O2 |
| Net Charge | 0 |
| Average Mass | 411.388 |
| Monoisotopic Mass | 411.16306 |
| SMILES | Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C17H20F3N7O2/c18-17(19,20)12-9-13(21)22-10-11(12)14-23-15(26-1-5-28-6-2-26)25-16(24-14)27-3-7-29-8-4-27/h9-10H,1-8H2,(H2,21,22) |
| InChIKey | ADGGYDAFIHSYFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bimiralisib (CHEBI:756587) has role antineoplastic agent (CHEBI:35610) |
| bimiralisib (CHEBI:756587) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| bimiralisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| NC-B5 | ChEMBL |
| NCB5 | ChEMBL |
| PI3K-IN-2 | ChEMBL |
| PQR-309 | ChEMBL |
| PQR309 | ChEMBL |
| Citations |
|---|