EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 361.373 |
| Monoisotopic Mass | 361.14378 |
| SMILES | CC[C@@H]1[C@H](F)C(=O)N[C@@H]1COc1nccc2cc(C(N)=O)c(OC)cc12 |
| InChI | InChI=1S/C18H20FN3O4/c1-3-10-13(22-17(24)15(10)19)8-26-18-11-7-14(25-2)12(16(20)23)6-9(11)4-5-21-18/h4-7,10,13,15H,3,8H2,1-2H3,(H2,20,23)(H,22,24)/t10-,13+,15-/m0/s1 |
| InChIKey | JKDGKIBAOAFRPJ-ZBINZKHDSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zimlovisertib (CHEBI:756586) has role antirheumatic drug (CHEBI:35842) |
| zimlovisertib (CHEBI:756586) has role antiviral agent (CHEBI:22587) |
| zimlovisertib (CHEBI:756586) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| zimlovisertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pf 06650833 | ChEMBL |
| PF-06650833 | ChEMBL |
| Citations |
|---|