EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13ClF4N6O |
| Net Charge | 0 |
| Average Mass | 440.788 |
| Monoisotopic Mass | 440.07755 |
| SMILES | C[C@@H]1c2nnn(-c3ncc(F)cn3)c2CCN1C(=O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C18H13ClF4N6O/c1-9-15-13(29(27-26-15)17-24-7-10(20)8-25-17)5-6-28(9)16(30)11-3-2-4-12(14(11)19)18(21,22)23/h2-4,7-9H,5-6H2,1H3/t9-/m1/s1 |
| InChIKey | CWFVVQFVGMFTBD-SECBINFHSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-54175446 (CHEBI:756582) has role antidepressant (CHEBI:35469) |
| jnj-54175446 (CHEBI:756582) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| Synonym | Source |
|---|---|
| Jnj-54175446 | ChEMBL |
| Citations |
|---|