EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N6O |
| Net Charge | 0 |
| Average Mass | 450.546 |
| Monoisotopic Mass | 450.21681 |
| SMILES | CN1CCN(C(=O)c2ccc3cc(CCNc4ncnc5ccc(C#N)cc45)ccc3c2)CC1 |
| InChI | InChI=1S/C27H26N6O/c1-32-10-12-33(13-11-32)27(34)23-6-5-21-14-19(2-4-22(21)16-23)8-9-29-26-24-15-20(17-28)3-7-25(24)30-18-31-26/h2-7,14-16,18H,8-13H2,1H3,(H,29,30,31) |
| InChIKey | VNADJTWHOAMTLY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| senexin b (CHEBI:756580) has role antineoplastic agent (CHEBI:35610) |
| senexin b (CHEBI:756580) is a naphthoic acid (CHEBI:25483) |
| Synonyms | Source |
|---|---|
| BCD-115 | ChEMBL |
| Senexin b | ChEMBL |
| Citations |
|---|