EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N3O5S |
| Net Charge | 0 |
| Average Mass | 469.563 |
| Monoisotopic Mass | 469.16714 |
| SMILES | COc1c(/C=C/c2ccc(NS(C)(=O)=O)cc2)cc(-n2ccc(=O)nc2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C24H27N3O5S/c1-24(2,3)20-15-19(27-13-12-21(28)25-23(27)29)14-17(22(20)32-4)9-6-16-7-10-18(11-8-16)26-33(5,30)31/h6-15,26H,1-5H3,(H,25,28,29)/b9-6+ |
| InChIKey | XMZSTQYSBYEENY-RMKNXTFCSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abt-072 (CHEBI:756579) has role antiviral agent (CHEBI:22587) |
| abt-072 (CHEBI:756579) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Abt 072 | ChEMBL |
| ABT-072 | ChEMBL |
| ABT072 | ChEMBL |
| Citations |
|---|