EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17F3O4S |
| Net Charge | 0 |
| Average Mass | 470.468 |
| Monoisotopic Mass | 470.07996 |
| SMILES | CC(F)(F)c1cc(F)ccc1-c1sc2cc(O)ccc2c1Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C25H17F3O4S/c1-25(27,28)20-12-15(26)5-9-18(20)24-23(19-10-6-16(29)13-21(19)33-24)32-17-7-2-14(3-8-17)4-11-22(30)31/h2-13,29H,1H3,(H,30,31)/b11-4+ |
| InChIKey | SJXNPGGVGZXKKI-NYYWCZLTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lsz-102 (CHEBI:756578) has functional parent cinnamic acid (CHEBI:27386) |
| lsz-102 (CHEBI:756578) has role antineoplastic agent (CHEBI:35610) |
| lsz-102 (CHEBI:756578) is a olefinic compound (CHEBI:78840) |
| Synonyms | Source |
|---|---|
| LSZ-102 | ChEMBL |
| LSZ102 | ChEMBL |
| Citations |
|---|