EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N6O2 |
| Net Charge | 0 |
| Average Mass | 340.387 |
| Monoisotopic Mass | 340.16477 |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CCCCC1 |
| InChI | InChI=1S/C17H20N6O2/c1-10-7-11(21-13-8-12(18)19-9-20-13)16(25)23-14(10)15(24)22-17(23)5-3-2-4-6-17/h7-9H,2-6H2,1H3,(H,22,24)(H3,18,19,20,21) |
| InChIKey | HKTBYUWLRDZAJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomivosertib (CHEBI:756577) has role antineoplastic agent (CHEBI:35610) |
| tomivosertib (CHEBI:756577) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| tomivosertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Eft 508 | ChEMBL |
| Eft508 | ChEMBL |
| EFT-508 | ChEMBL |
| Citations |
|---|