EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H28ClFN8O5 |
| Net Charge | 0 |
| Average Mass | 659.078 |
| Monoisotopic Mass | 658.18552 |
| SMILES | CN1CCN(c2cccc3c2CCN(C(=O)/C=C/c2c(-n4cnnn4)ccc(Cl)c2F)[C@@H]3C(=O)Nc2ccc(C(=O)O)cc2)C(=O)C1 |
| InChI | InChI=1S/C32H28ClFN8O5/c1-39-15-16-40(28(44)17-39)25-4-2-3-22-21(25)13-14-41(30(22)31(45)36-20-7-5-19(6-8-20)32(46)47)27(43)12-9-23-26(42-18-35-37-38-42)11-10-24(33)29(23)34/h2-12,18,30H,13-17H2,1H3,(H,36,45)(H,46,47)/b12-9+/t30-/m0/s1 |
| InChIKey | WYFCZWSWFGJODV-MIANJLSGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-962212 (CHEBI:756576) has role anticoagulant (CHEBI:50249) |
| bms-962212 (CHEBI:756576) is a amidobenzoic acid (CHEBI:48470) |
| Synonym | Source |
|---|---|
| BMS-962212 | ChEMBL |
| Citations |
|---|