EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756573 - gsk2982772
| Formula | C20H19N5O3 |
| Net Charge | 0 |
| Average Mass | 377.404 |
| Monoisotopic Mass | 377.14879 |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2nnc(Cc3ccccc3)n2)COc2ccccc21 |
| InChI | InChI=1S/C20H19N5O3/c1-25-15-9-5-6-10-16(15)28-12-14(20(25)27)21-19(26)18-22-17(23-24-18)11-13-7-3-2-4-8-13/h2-10,14H,11-12H2,1H3,(H,21,26)(H,22,23,24)/t14-/m0/s1 |
| InChIKey | LYPAFUINURXJSG-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antipsoriatic A drug used to treat psoriasis. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk2982772 (CHEBI:756573) has role anti-inflammatory agent (CHEBI:67079) |
| gsk2982772 (CHEBI:756573) has role antipsoriatic (CHEBI:50748) |
| gsk2982772 (CHEBI:756573) has role antirheumatic drug (CHEBI:35842) |
| gsk2982772 (CHEBI:756573) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| Gsk2982772 | ChEMBL |
| Citations |
|---|