EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31ClF3N5O3 |
| Net Charge | 0 |
| Average Mass | 590.046 |
| Monoisotopic Mass | 589.20675 |
| SMILES | CCOC(=O)[C@@H]1CC2(CCN(c3cc(O[C@H](c4ccc(Cl)cc4-c4ccccc4)C(F)(F)F)nc(N)n3)CC2)CN1 |
| InChI | InChI=1S/C29H31ClF3N5O3/c1-2-40-26(39)22-16-28(17-35-22)10-12-38(13-11-28)23-15-24(37-27(34)36-23)41-25(29(31,32)33)20-9-8-19(30)14-21(20)18-6-4-3-5-7-18/h3-9,14-15,22,25,35H,2,10-13,16-17H2,1H3,(H2,34,36,37)/t22-,25+/m0/s1 |
| InChIKey | TZSZZENYCISATO-WIOPSUGQSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rodatristat ethyl (CHEBI:756572) has role antihypertensive agent (CHEBI:35674) |
| rodatristat ethyl (CHEBI:756572) is a biphenyls (CHEBI:22888) |
| rodatristat ethyl (CHEBI:756572) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| KAR-5585 | ChEMBL |
| KAR5585 | ChEMBL |
| Rodatristat ethyl | ChEMBL |
| Citations |
|---|