EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N4O3S2 |
| Net Charge | 0 |
| Average Mass | 402.501 |
| Monoisotopic Mass | 402.08203 |
| SMILES | Cc1nc(N(C)C(=O)Cc2ccc(-c3ccccn3)cc2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C18H18N4O3S2/c1-12-17(27(19,24)25)26-18(21-12)22(2)16(23)11-13-6-8-14(9-7-13)15-5-3-4-10-20-15/h3-10H,11H2,1-2H3,(H2,19,24,25) |
| InChIKey | IVZKZONQVYTCKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pritelivir (CHEBI:756571) has role anti-HSV agent (CHEBI:64952) |
| pritelivir (CHEBI:756571) has role antiinfective agent (CHEBI:35441) |
| pritelivir (CHEBI:756571) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| pritelivir | WHO MedNet |
| Synonyms | Source |
|---|---|
| AIC-090093 | ChEMBL |
| AIC090093 | ChEMBL |
| AIC-316 | ChEMBL |
| AIC316 | ChEMBL |
| BAY 57-1293 | ChEMBL |
| BAY-57-1293 | ChEMBL |
| Citations |
|---|